ChemNet > CAS > 95883-10-6 2,5-Dimethylcinnamic acid
95883-10-6 2,5-Dimethylcinnamic acid
| Produkt-Name |
2,5-Dimethylcinnamic acid |
| Englischer Name |
2,5-Dimethylcinnamic acid;(2E)-3-(2,5-dimethylphenyl)prop-2-enoic acid |
| Molekulare Formel |
C11H12O2 |
| Molecular Weight |
176.2118 |
| InChI |
InChI=1/C11H12O2/c1-8-3-4-9(2)10(7-8)5-6-11(12)13/h3-7H,1-2H3,(H,12,13)/b6-5+ |
| CAS Registry Number |
95883-10-6 |
| Molecular Structure |
|
| Dichte |
1.118g/cm3 |
| Siedepunkt |
307°C at 760 mmHg |
| Brechungsindex |
1.592 |
| Flammpunkt |
212.2°C |
| Dampfdruck |
0.000324mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
