ChemNet > CAS > 96424-68-9 2-Bromo-3-chloropyridine
96424-68-9 2-Bromo-3-chloropyridine
| Produkt-Name |
2-Bromo-3-chloropyridine |
| Englischer Name |
2-Bromo-3-chloropyridine; |
| Molekulare Formel |
C5H3BrClN |
| Molecular Weight |
192.441 |
| InChI |
InChI=1/C5H3BrClN/c6-5-4(7)2-1-3-8-5/h1-3H |
| CAS Registry Number |
96424-68-9 |
| Molecular Structure |
|
| Dichte |
1.736g/cm3 |
| Siedepunkt |
223.9°C at 760 mmHg |
| Brechungsindex |
1.581 |
| Flammpunkt |
89.2°C |
| Dampfdruck |
0.14mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
