97-95-0 2-Ethyl-1-butanol
Produkt-Name |
2-Ethyl-1-butanol |
Englischer Name |
2-Ethyl-1-butanol; 2-Ethylbutyl alcohol; 2-ethylbutan-1-ol |
Molekulare Formel |
C6H14O |
Molecular Weight |
102.1748 |
InChI |
InChI=1/C6H14O/c1-3-6(4-2)5-7/h6-7H,3-5H2,1-2H3 |
CAS Registry Number |
97-95-0 |
EINECS |
202-621-4 |
Molecular Structure |
|
Dichte |
0.814g/cm3 |
Schmelzpunkt |
-15℃ |
Siedepunkt |
146.5°C at 760 mmHg |
Brechungsindex |
1.413 |
Flammpunkt |
58.3°C |
Dampfdruck |
1.81mmHg at 25°C |
Gefahrensymbole |
Xn:Harmful;
|
Risk Codes |
R21/22:Harmful in contact with skin and if swallowed.;
|
Safety Beschreibung |
|
|