ChemNet > CAS > 98892-75-2 1-Butyl-2,3-dimethylimidazolium chloride
98892-75-2 1-Butyl-2,3-dimethylimidazolium chloride
| Produkt-Name |
1-Butyl-2,3-dimethylimidazolium chloride |
| Englischer Name |
1-Butyl-2,3-dimethylimidazolium chloride;1-butyl-2,3-dimethyl-1H-imidazol-3-ium chloride; 1-butyl-2,3-dimethyl-1H-imidazol-3-ium |
| Molekulare Formel |
C9H17N2 |
| Molecular Weight |
153.2441 |
| InChI |
InChI=1/C9H17N2/c1-4-5-6-11-8-7-10(3)9(11)2/h7-8H,4-6H2,1-3H3/q+1 |
| CAS Registry Number |
98892-75-2 |
| Molecular Structure |
|
| Schmelzpunkt |
99℃ |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
