ChemNet > CAS > 1002-84-2 n-Pentadecanoic acid
1002-84-2 n-Pentadecanoic acid
| product Name |
n-Pentadecanoic acid |
| CAS No |
1002-84-2 |
| Synonyms |
Pentadecanoic acid; n-Caprylic Acid Sodium Salt |
| Molecular Formula |
C15H30O2 |
| Molecular Weight |
242.3975 |
| InChI |
InChI=1/C15H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H2,1H3,(H,16,17) |
| EINECS |
213-693-1 |
| Molecular Structure |
|
| Density |
0.895g/cm3 |
| Melting point |
51-53℃ |
| Boiling point |
330.4°C at 760 mmHg |
| Refractive index |
1.452 |
| Flash point |
149.6°C |
| Vapour Pressur |
6.67E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
