ChemNet > CAS > 10047-28-6 butyl thioglycolate
10047-28-6 butyl thioglycolate
| product Name |
butyl thioglycolate |
| CAS No |
10047-28-6 |
| Molecular Formula |
C6H12O2S |
| Molecular Weight |
148.2233 |
| InChI |
InChI=1/C6H12O2S/c1-2-3-4-9-6(8)5-7/h7H,2-5H2,1H3 |
| EINECS |
233-156-5 |
| Molecular Structure |
|
| Density |
1.088g/cm3 |
| Boiling point |
220.125°C at 760 mmHg |
| Refractive index |
1.491 |
| Flash point |
86.929°C |
| Vapour Pressur |
0.024mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
