ChemNet > CAS > 10075-62-4 1,4-Dimethoxynaphthalene
10075-62-4 1,4-Dimethoxynaphthalene
| product Name |
1,4-Dimethoxynaphthalene |
| CAS No |
10075-62-4 |
| Molecular Formula |
C12H12O2 |
| Molecular Weight |
188.2225 |
| InChI |
InChI=1/C12H12O2/c1-13-11-7-8-12(14-2)10-6-4-3-5-9(10)11/h3-8H,1-2H3 |
| EINECS |
233-209-2 |
| Molecular Structure |
|
| Density |
1.097g/cm3 |
| Boiling point |
317.6°C at 760 mmHg |
| Refractive index |
1.584 |
| Flash point |
134.3°C |
| Vapour Pressur |
0.000708mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
