ChemNet > CAS > 1008-95-3 4-(1,3-oxazol-5-yl)aniline
1008-95-3 4-(1,3-oxazol-5-yl)aniline
| product Name |
4-(1,3-oxazol-5-yl)aniline |
| CAS No |
1008-95-3 |
| Synonyms |
4-(oxazol-5-yl)aniline |
| Molecular Formula |
C9H8N2O |
| Molecular Weight |
160.1726 |
| InChI |
InChI=1/C9H8N2O/c10-8-3-1-7(2-4-8)9-5-11-6-12-9/h1-6H,10H2 |
| Molecular Structure |
|
| Density |
1.204g/cm3 |
| Melting point |
148℃ |
| Boiling point |
318.7°C at 760 mmHg |
| Refractive index |
1.599 |
| Flash point |
146.5°C |
| Vapour Pressur |
0.000356mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
