ChemNet > CAS > 100836-85-9 (R)-(+)-2-Benzyloxypropionic acid
100836-85-9 (R)-(+)-2-Benzyloxypropionic acid
| product Name |
(R)-(+)-2-Benzyloxypropionic acid |
| CAS No |
100836-85-9 |
| Synonyms |
O-Benzyl-D-lactic acid; (2R)-2-(benzyloxy)propanoic acid; (R)-(+)-2-Benzyloxypropanoic acid |
| Molecular Formula |
C10H12O3 |
| Molecular Weight |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-8(10(11)12)13-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12)/t8-/m1/s1 |
| Molecular Structure |
|
| Density |
1.15g/cm3 |
| Boiling point |
328.2°C at 760 mmHg |
| Refractive index |
1.529 |
| Flash point |
130.4°C |
| Vapour Pressur |
7.79E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
