ChemNet > CAS > 100859-84-5 2-Chloro isonicotinamide
100859-84-5 2-Chloro isonicotinamide
| product Name |
2-Chloro isonicotinamide |
| CAS No |
100859-84-5 |
| Synonyms |
6-methyl-5-nitropyridin-2(1H)-one; 2-chloropyridine-4-carboxamide |
| Molecular Formula |
C6H5ClN2O |
| Molecular Weight |
156.5697 |
| InChI |
InChI=1/C6H5ClN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
| Molecular Structure |
|
| Density |
1.381g/cm3 |
| Melting point |
193℃ |
| Boiling point |
312.2°C at 760 mmHg |
| Refractive index |
1.588 |
| Flash point |
142.6°C |
| Vapour Pressur |
0.000535mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
