ChemNet > CAS > 101-99-5 N-Phenylurethane
101-99-5 N-Phenylurethane
| product Name |
N-Phenylurethane |
| CAS No |
101-99-5 |
| Synonyms |
Ethyl carbanilate~Ethyl N-phenylcarbamate; ethyl phenylcarbamate |
| Molecular Formula |
C9H11NO2 |
| Molecular Weight |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| EINECS |
202-995-9 |
| Molecular Structure |
|
| Density |
1.136g/cm3 |
| Boiling point |
238°C at 760 mmHg |
| Refractive index |
1.558 |
| Flash point |
79.2°C |
| Vapour Pressur |
0.0434mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R40:Possible risks of irreversible effects.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
