ChemNet > CAS > 1011-16-1 1-(2-fluorophenyl)piperazine monohydro-chloride,
1011-16-1 1-(2-fluorophenyl)piperazine monohydro-chloride,
| product Name |
1-(2-fluorophenyl)piperazine monohydro-chloride, |
| CAS No |
1011-16-1 |
| Synonyms |
1-(2-Fluorophenyl)piperazine monohydrochloride; 1-(2-fluorophenyl)piperazine hydrochloride; 1-(2-fluorophenyl)piperazine hcl; 1-(2-FLUOROPHENYL)PIPERAZINE HYDROCHLORIDE;
|
| Molecular Formula |
C10H14ClFN2 |
| Molecular Weight |
216.683 |
| InChI |
InChI=1/C10H13FN2.ClH/c11-9-3-1-2-4-10(9)13-7-5-12-6-8-13;/h1-4,12H,5-8H2;1H |
| Molecular Structure |
|
| Melting point |
187℃ |
| Boiling point |
283.8°C at 760 mmHg |
| Flash point |
125.4°C |
| Vapour Pressur |
0.0031mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
