ChemNet > CAS > 1011-92-3 alpha-cyanocinnamic acid
1011-92-3 alpha-cyanocinnamic acid
| product Name |
alpha-cyanocinnamic acid |
| CAS No |
1011-92-3 |
| Synonyms |
Cyanocinnamicacid; (2E)-2-cyano-3-phenylprop-2-enoic acid; (2Z)-2-cyano-3-phenylprop-2-enoic acid; (2E)-2-cyano-3-phenylprop-2-enoate |
| Molecular Formula |
C10H6NO2 |
| Molecular Weight |
172.1607 |
| InChI |
InChI=1/C10H7NO2/c11-7-9(10(12)13)6-8-4-2-1-3-5-8/h1-6H,(H,12,13)/p-1/b9-6+ |
| EINECS |
213-788-8 |
| Molecular Structure |
|
| Boiling point |
337.9°C at 760 mmHg |
| Flash point |
158.1°C |
| Vapour Pressur |
3.98E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
