ChemNet > CAS > 1013-25-8 1-(2,5-Dimethylphenyl)piperazine
1013-25-8 1-(2,5-Dimethylphenyl)piperazine
| product Name |
1-(2,5-Dimethylphenyl)piperazine |
| CAS No |
1013-25-8 |
| Synonyms |
1-(2,5-Xylyl)piperazine; 4-(2,5-dimethylphenyl)piperazin-1-ium |
| Molecular Formula |
C12H19N2 |
| Molecular Weight |
191.2921 |
| InChI |
InChI=1/C12H18N2/c1-10-3-4-11(2)12(9-10)14-7-5-13-6-8-14/h3-4,9,13H,5-8H2,1-2H3/p+1 |
| EINECS |
213-795-6 |
| Molecular Structure |
|
| Melting point |
42-46℃ |
| Boiling point |
332.5°C at 760 mmHg |
| Flash point |
151.7°C |
| Vapour Pressur |
0.000146mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
