1015-89-0 6(5H)-phenanthridinone
product Name |
6(5H)-phenanthridinone |
CAS No |
1015-89-0 |
Synonyms |
Phenanthridinone; phenanthridin-6(5H)-one; 6(5H)-Phenanthridone; phenantridine-6(5H)-one |
Molecular Formula |
C13H9NO |
Molecular Weight |
195.2167 |
InChI |
InChI=1/C13H9NO/c15-13-11-7-2-1-5-9(11)10-6-3-4-8-12(10)14-13/h1-8H,(H,14,15) |
EINECS |
213-804-3 |
Molecular Structure |
|
Density |
1.231g/cm3 |
Melting point |
290-292℃ |
Boiling point |
274.843°C at 760 mmHg |
Refractive index |
1.642 |
Flash point |
158.663°C |
Vapour Pressur |
0.005mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|