ChemNet > CAS > 10160-87-9 3,3-diethoxy-1-propyne
10160-87-9 3,3-diethoxy-1-propyne
| product Name |
3,3-diethoxy-1-propyne |
| CAS No |
10160-87-9 |
| Synonyms |
Propiolaldehyde diethyl acetal; Propargylaldehyde diethyl acetal; 3,3-diethoxyprop-1-yne; Propynal diethyl acetal |
| Molecular Formula |
C7H12O2 |
| Molecular Weight |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-4-7(8-5-2)9-6-3/h1,7H,5-6H2,2-3H3 |
| EINECS |
233-430-4 |
| Molecular Structure |
|
| Density |
0.909g/cm3 |
| Boiling point |
139°C at 760 mmHg |
| Refractive index |
1.421 |
| Flash point |
32.2°C |
| Vapour Pressur |
8.16mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
