ChemNet > CAS > 10192-85-5 Potassium acrylate
10192-85-5 Potassium acrylate
| product Name |
Potassium acrylate |
| CAS No |
10192-85-5 |
| Synonyms |
PotassiumAcrylateinmethanol; Potassiumacrylate; Acrylic acid potassium salt; 2-Propenoic acid, potassium salt; prop-2-enoic acid; potassium prop-2-enoate |
| Molecular Formula |
C3H3KO2 |
| Molecular Weight |
110.153 |
| InChI |
InChI=1/C3H4O2.K/c1-2-3(4)5;/h2H,1H2,(H,4,5);/q;+1/p-1 |
| EINECS |
233-473-9 |
| Molecular Structure |
|
| Melting point |
194℃ |
| Boiling point |
141°C at 760 mmHg |
| Flash point |
61.6°C |
| Vapour Pressur |
3.42mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
