ChemNet > CAS > 102-38-5 3-Nitroformanilide
102-38-5 3-Nitroformanilide
| product Name |
3-Nitroformanilide |
| CAS No |
102-38-5 |
| Synonyms |
N-(3-nitrophenyl)formamide |
| Molecular Formula |
C7H6N2O3 |
| Molecular Weight |
166.1341 |
| InChI |
InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
| Molecular Structure |
|
| Density |
1.407g/cm3 |
| Boiling point |
368.5°C at 760 mmHg |
| Refractive index |
1.641 |
| Flash point |
176.7°C |
| Vapour Pressur |
1.27E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
