10203-32-4 4-Dodecanol
product Name |
4-Dodecanol |
CAS No |
10203-32-4 |
Synonyms |
n-Octyl-n-propyl carbinol; dodecan-4-ol |
Molecular Formula |
C12H26O |
Molecular Weight |
186.3342 |
InChI |
InChI=1/C12H26O/c1-3-5-6-7-8-9-11-12(13)10-4-2/h12-13H,3-11H2,1-2H3 |
EINECS |
233-502-5 |
Molecular Structure |
|
Density |
0.829g/cm3 |
Boiling point |
245.5°C at 760 mmHg |
Refractive index |
1.439 |
Flash point |
100.1°C |
Vapour Pressur |
0.00476mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|