ChemNet > CAS > 102170-56-9 2-Bromo-6-methyl-4-nitroaniline
102170-56-9 2-Bromo-6-methyl-4-nitroaniline
| product Name |
2-Bromo-6-methyl-4-nitroaniline |
| CAS No |
102170-56-9 |
| Molecular Formula |
C7H7BrN2O2 |
| Molecular Weight |
231.0467 |
| InChI |
InChI=1/C7H7BrN2O2/c1-4-2-5(10(11)12)3-6(8)7(4)9/h2-3H,9H2,1H3 |
| Molecular Structure |
|
| Density |
1.698g/cm3 |
| Melting point |
177-181℃ |
| Boiling point |
366°C at 760 mmHg |
| Refractive index |
1.648 |
| Flash point |
175.2°C |
| Vapour Pressur |
1.51E-05mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
