ChemNet > CAS > 10273-90-2 3-Methyl-2-phenylpyridine
10273-90-2 3-Methyl-2-phenylpyridine
| product Name |
3-Methyl-2-phenylpyridine |
| CAS No |
10273-90-2 |
| Synonyms |
2-Phenyl-3-picoline |
| Molecular Formula |
C12H11N |
| Molecular Weight |
169.2224 |
| InChI |
InChI=1/C12H11N/c1-10-6-5-9-13-12(10)11-7-3-2-4-8-11/h2-9H,1H3 |
| EINECS |
233-619-1 |
| Molecular Structure |
|
| Density |
1.03g/cm3 |
| Boiling point |
278.2°C at 760 mmHg |
| Refractive index |
1.568 |
| Flash point |
96.1°C |
| Vapour Pressur |
0.00732mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
