ChemNet > CAS > 10315-03-4 4-Acetyl-4-phenylpiperidine hydrochloride
10315-03-4 4-Acetyl-4-phenylpiperidine hydrochloride
| product Name |
4-Acetyl-4-phenylpiperidine hydrochloride |
| CAS No |
10315-03-4 |
| Molecular Formula |
C13H18NO |
| Molecular Weight |
204.2876 |
| InChI |
InChI=1/C13H17NO/c1-11(15)13(7-9-14-10-8-13)12-5-3-2-4-6-12/h2-6,14H,7-10H2,1H3/p+1 |
| EINECS |
233-694-0 |
| Molecular Structure |
|
| Melting point |
232-234℃ |
| Boiling point |
325.2°C at 760 mmHg |
| Flash point |
125.7°C |
| Vapour Pressur |
0.000234mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
