ChemNet > CAS > 10352-44-0 4-Acetamidothioanisole,(4-Methylmercaptoacetanilide)
10352-44-0 4-Acetamidothioanisole,(4-Methylmercaptoacetanilide)
| product Name |
4-Acetamidothioanisole,(4-Methylmercaptoacetanilide) |
| CAS No |
10352-44-0 |
| Synonyms |
4-Acetamidothioanisole; 4-Methylmercaptoacetanilide; N-[4-(methylsulfanyl)phenyl]acetamide |
| Molecular Formula |
C9H11NOS |
| Molecular Weight |
181.2547 |
| InChI |
InChI=1/C9H11NOS/c1-7(11)10-8-3-5-9(12-2)6-4-8/h3-6H,1-2H3,(H,10,11) |
| Molecular Structure |
|
| Density |
1.14g/cm3 |
| Boiling point |
370.5°C at 760 mmHg |
| Refractive index |
1.578 |
| Flash point |
177.9°C |
| Vapour Pressur |
1.1E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
