ChemNet > CAS > 10352-88-2 trans-2-Heptenoic acid
10352-88-2 trans-2-Heptenoic acid
| product Name |
trans-2-Heptenoic acid |
| CAS No |
10352-88-2 |
| Synonyms |
Heptenoicacidtech; hept-2-enoate; (2E)-hept-2-enoic acid |
| Molecular Formula |
C7H12O2 |
| Molecular Weight |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-2-3-4-5-6-7(8)9/h5-6H,2-4H2,1H3,(H,8,9)/b6-5+ |
| EINECS |
233-769-8 |
| Molecular Structure |
|
| Density |
0.968g/cm3 |
| Boiling point |
226.6°C at 760 mmHg |
| Refractive index |
1.457 |
| Flash point |
133.4°C |
| Vapour Pressur |
0.0295mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
