ChemNet > CAS > 1036-72-2 5,7-Dimethoxyflavanone
1036-72-2 5,7-Dimethoxyflavanone
| product Name |
5,7-Dimethoxyflavanone |
| CAS No |
1036-72-2 |
| Synonyms |
Pinocembrin dimethyl ether; 5,7-dimethoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| Molecular Formula |
C17H16O4 |
| Molecular Weight |
284.3065 |
| InChI |
InChI=1/C17H16O4/c1-19-12-8-15(20-2)17-13(18)10-14(21-16(17)9-12)11-6-4-3-5-7-11/h3-9,14H,10H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.204g/cm3 |
| Boiling point |
468.8°C at 760 mmHg |
| Refractive index |
1.574 |
| Flash point |
209.4°C |
| Vapour Pressur |
5.79E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
