ChemNet > CAS > 1038-66-0 4,4'-diaminooctafluorobiphenyl
1038-66-0 4,4'-diaminooctafluorobiphenyl
| product Name |
4,4'-diaminooctafluorobiphenyl |
| CAS No |
1038-66-0 |
| Synonyms |
2,2,3,3,5,5,6,6-Octafluoro-4,4-bibenzenamine; Octafluorobenzidine; octafluoro-4,4-biphenylenediamine; 4,4'-dibromo-2,2',3,3',5,5',6,6'-octafluorobiphenyl |
| Molecular Formula |
C12Br2F8 |
| Molecular Weight |
455.9236 |
| InChI |
InChI=1/C12Br2F8/c13-3-9(19)5(15)1(6(16)10(3)20)2-7(17)11(21)4(14)12(22)8(2)18 |
| EINECS |
213-861-4 |
| Molecular Structure |
|
| Density |
2.065g/cm3 |
| Melting point |
175-179℃ |
| Boiling point |
295.4°C at 760 mmHg |
| Refractive index |
1.511 |
| Flash point |
132.4°C |
| Vapour Pressur |
0.0027mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
