ChemNet > CAS > 10477-47-1 Propargyl acrylate
10477-47-1 Propargyl acrylate
| product Name |
Propargyl acrylate |
| CAS No |
10477-47-1 |
| Synonyms |
Acrylic acid propargyl ester~2-Propyn-1-yl propenoate; prop-2-yn-1-yl prop-2-enoate |
| Molecular Formula |
C6H6O2 |
| Molecular Weight |
110.1106 |
| InChI |
InChI=1/C6H6O2/c1-3-5-8-6(7)4-2/h1,4H,2,5H2 |
| EINECS |
233-975-8 |
| Molecular Structure |
|
| Density |
1.001g/cm3 |
| Boiling point |
129.1°C at 760 mmHg |
| Refractive index |
1.443 |
| Flash point |
32.2°C |
| Vapour Pressur |
10.3mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
