ChemNet > CAS > 10487-71-5 Crotonyl chloride
10487-71-5 Crotonyl chloride
| product Name |
Crotonyl chloride |
| CAS No |
10487-71-5 |
| Synonyms |
2-Butenoyl chloride; But-2-enoyl chloride |
| Molecular Formula |
C4H5ClO |
| Molecular Weight |
104.5349 |
| InChI |
InChI=1/C4H5ClO/c1-2-3-4(5)6/h2-3H,1H3/b3-2- |
| EINECS |
234-010-3 |
| Molecular Structure |
|
| Density |
1.081g/cm3 |
| Boiling point |
124.499°C at 760 mmHg |
| Refractive index |
1.441 |
| Flash point |
35°C |
| Vapour Pressur |
12.707mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R10:Flammable.;
R34:Causes burns.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
|
