ChemNet > CAS > 104968-58-3 3,5-Dimethoxyphenyl isothiocyanate
104968-58-3 3,5-Dimethoxyphenyl isothiocyanate
| product Name |
3,5-Dimethoxyphenyl isothiocyanate |
| CAS No |
104968-58-3 |
| Synonyms |
1-isothiocyanato-3,5-dimethoxybenzene |
| Molecular Formula |
C9H9NO2S |
| Molecular Weight |
195.2383 |
| InChI |
InChI=1/C9H9NO2S/c1-11-8-3-7(10-6-13)4-9(5-8)12-2/h3-5H,1-2H3 |
| Molecular Structure |
|
| Density |
1.12g/cm3 |
| Melting point |
50-52℃ |
| Boiling point |
338.1°C at 760 mmHg |
| Refractive index |
1.537 |
| Flash point |
158.3°C |
| Vapour Pressur |
0.000197mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
