ChemNet > CAS > 105-05-5 1,4-Diethylbenzene
105-05-5 1,4-Diethylbenzene
| product Name |
1,4-Diethylbenzene |
| CAS No |
105-05-5 |
| Synonyms |
Benzene, 1,4-diethyl-; Benzene, p-diethyl-; HSDB 4083; p-Diethylbenzene; p-Ethylethylbenzene; butan-2-ylbenzene; PDEB |
| Molecular Formula |
C10H14 |
| Molecular Weight |
134.2182 |
| InChI |
InChI=1/C10H14/c1-3-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
| EINECS |
203-265-2 |
| Molecular Structure |
|
| Density |
0.86g/cm3 |
| Melting point |
-43℃ |
| Boiling point |
173.3°C at 760 mmHg |
| Refractive index |
1.489 |
| Flash point |
46.3°C |
| Vapour Pressur |
1.7mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
