ChemNet > CAS > 10502-44-0 4-methoxymandelic acid
10502-44-0 4-methoxymandelic acid
| product Name |
4-methoxymandelic acid |
| CAS No |
10502-44-0 |
| Synonyms |
alpha-Hydroxy-4-methoxyphenylacetic acid; hydroxy(4-methoxyphenyl)acetic acid; (2S)-hydroxy(4-methoxyphenyl)ethanoic acid |
| Molecular Formula |
C9H10O4 |
| Molecular Weight |
182.1733 |
| InChI |
InChI=1/C9H10O4/c1-13-7-4-2-6(3-5-7)8(10)9(11)12/h2-5,8,10H,1H3,(H,11,12)/t8-/m0/s1 |
| EINECS |
234-031-8 |
| Molecular Structure |
|
| Density |
1.309g/cm3 |
| Melting point |
108-111℃ |
| Boiling point |
370.4°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
152.6°C |
| Vapour Pressur |
3.86E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
