ChemNet > CAS > 10516-71-9 3-(3-methoxyphenyl)propionic acid
10516-71-9 3-(3-methoxyphenyl)propionic acid
| product Name |
3-(3-methoxyphenyl)propionic acid |
| CAS No |
10516-71-9 |
| Synonyms |
3-Methoxyhydrocinnamic acid; 3-(3-methoxyphenyl)propanoic acid |
| Molecular Formula |
C10H12O3 |
| Molecular Weight |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-13-9-4-2-3-8(7-9)5-6-10(11)12/h2-4,7H,5-6H2,1H3,(H,11,12) |
| EINECS |
234-049-6 |
| Molecular Structure |
|
| Density |
1.144g/cm3 |
| Melting point |
43-45℃ |
| Boiling point |
318.1°C at 760 mmHg |
| Refractive index |
1.53 |
| Flash point |
125.6°C |
| Vapour Pressur |
0.000155mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
