ChemNet > CAS > 105250-17-7 2-Aminopyridine-4-methanol
105250-17-7 2-Aminopyridine-4-methanol
| product Name |
2-Aminopyridine-4-methanol |
| CAS No |
105250-17-7 |
| Synonyms |
(2-Amino-pyridin-4-yl)-methanol; 2-amino-4-(hydroxymethyl)pyridinium; 2-Amino-4-pyridinemethanol |
| Molecular Formula |
C6H9N2O |
| Molecular Weight |
125.1479 |
| InChI |
InChI=1/C6H8N2O/c7-6-3-5(4-9)1-2-8-6/h1-3,9H,4H2,(H2,7,8)/p+1 |
| Molecular Structure |
|
| Boiling point |
329.5°C at 760 mmHg |
| Flash point |
153.1°C |
| Vapour Pressur |
7.1E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
