ChemNet > CAS > 10534-89-1 Hexaaminecobalt(III) chloride
10534-89-1 Hexaaminecobalt(III) chloride
| product Name |
Hexaaminecobalt(III) chloride |
| CAS No |
10534-89-1 |
| Synonyms |
Hexaamine cobalt(III) chloride; hexamminecobalttrichloride; Hexaamminecobalt (III) chloride; Hexamminecobalt(III) chloride; hexaamminecobalt trichloride; Hexaamminecobaltchlorideorangepowder; cobalt(3+) chloride ammoniate (1:3:6); azanide; cobalt |
| Molecular Formula |
C6H12ClCoN4 |
| Molecular Weight |
234.5719 |
| InChI |
InChI=1/C6H12N4.ClH.Co/c1-7-2-9-4-8(1)5-10(3-7)6-9;;/h1-6H2;1H;/q;;+2/p-1 |
| EINECS |
234-103-9 |
| Molecular Structure |
|
| Melting point |
217℃ |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
