ChemNet > CAS > 10570-67-9 4-iodo-2,6-dimethylphenol
10570-67-9 4-iodo-2,6-dimethylphenol
| product Name |
4-iodo-2,6-dimethylphenol |
| Synonyms |
2,6-Dimethyl-4-iodophenol; 4-IODO-2,6-XYLENOL; 4-lodo-2,6-dimethyl phenol |
| Molecular Formula |
C8H9IO |
| Molecular Weight |
248.0609 |
| InChI |
InChI=1/C8H9IO/c1-5-3-7(9)4-6(2)8(5)10/h3-4,10H,1-2H3 |
| CAS Registry Number |
10570-67-9 |
| Molecular Structure |
|
| Density |
1.74g/cm3 |
| Melting point |
96℃ |
| Boiling point |
278.9°C at 760 mmHg |
| Refractive index |
1.629 |
| Flash point |
122.5°C |
| Vapour Pressur |
0.00244mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
4-iodo-2,6-dimethylphenol Material Safety Data Sheet
|
|
