ChemNet > CAS > 10595-06-9 2-Phenoxyethyl methacrylate
10595-06-9 2-Phenoxyethyl methacrylate
| product Name |
2-Phenoxyethyl methacrylate |
| CAS No |
10595-06-9 |
| Molecular Formula |
C12H14O3 |
| Molecular Weight |
206.2378 |
| InChI |
InChI=1/C12H14O3/c1-9(2)12(13)15-10(3)14-11-7-5-4-6-8-11/h4-8,10H,1H2,2-3H3 |
| EINECS |
234-201-1 |
| Molecular Structure |
|
| Density |
1.059g/cm3 |
| Boiling point |
292.352°C at 760 mmHg |
| Refractive index |
1.501 |
| Flash point |
118.277°C |
| Vapour Pressur |
0.002mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
