ChemNet > CAS > 106-42-3 p-Xylene
106-42-3 p-Xylene
| product Name |
p-Xylene |
| Synonyms |
1,4-Dimethylbenzene; para-xylene; Dibencoside; 1,4-xylene |
| Molecular Formula |
C8H10 |
| Molecular Weight |
106.1674 |
| InChI |
InChI:1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3 |
| CAS Registry Number |
106-42-3 |
| EINECS |
203-396-5 |
| Molecular Structure |
|
| Melting point |
13-13℃ |
| Boiling point |
139.61°C at 760 mmHg |
| Flash point |
24.627°C |
| Vapour Pressur |
7.943mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R10:Flammable.;
R20/21:Harmful by inhalation and in contact with skin.;
R38:Irritating to skin.;
|
| Safety Description |
S25:Avoid contact with eyes.;
|
| MSDS |
p-Xylene Material Safety Data Sheet
|
|
