ChemNet > CAS > 107-84-6 1-Chloro-3-methylbutane
107-84-6 1-Chloro-3-methylbutane
| product Name |
1-Chloro-3-methylbutane |
| CAS No |
107-84-6 |
| Synonyms |
Isoamyl chloride~Isopentyl chloride |
| Molecular Formula |
C5H11Cl |
| Molecular Weight |
106.5938 |
| InChI |
InChI=1/C5H11Cl/c1-5(2)3-4-6/h5H,3-4H2,1-2H3 |
| EINECS |
203-525-5 |
| Molecular Structure |
|
| Density |
0.867g/cm3 |
| Boiling point |
98.3°C at 760 mmHg |
| Refractive index |
1.403 |
| Flash point |
9.8°C |
| Vapour Pressur |
46.2mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R11:Highly flammable.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
