ChemNet > CAS > 1074-16-4 2-Bromophenethylalcohol
1074-16-4 2-Bromophenethylalcohol
| product Name |
2-Bromophenethylalcohol |
| CAS No |
1074-16-4 |
| Synonyms |
2-(2-Bromophenyl)-ethanol |
| Molecular Formula |
C8H9BrO |
| Molecular Weight |
201.0605 |
| InChI |
InChI=1/C8H9BrO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6H2 |
| Molecular Structure |
|
| Density |
1.479g/cm3 |
| Boiling point |
269.3°C at 760 mmHg |
| Refractive index |
1.576 |
| Flash point |
116.7°C |
| Vapour Pressur |
0.0036mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
