ChemNet > CAS > 107572-07-6 2-(4-Chlorophenylthio)benzaldehyde
107572-07-6 2-(4-Chlorophenylthio)benzaldehyde
| product Name |
2-(4-Chlorophenylthio)benzaldehyde |
| CAS No |
107572-07-6 |
| Synonyms |
2-[(4-Chlorophenyl)thio]benzaldehyde; 2-[(4-chlorophenyl)sulfanyl]benzaldehyde |
| Molecular Formula |
C13H9ClOS |
| Molecular Weight |
248.728 |
| InChI |
InChI=1/C13H9ClOS/c14-11-5-7-12(8-6-11)16-13-4-2-1-3-10(13)9-15/h1-9H |
| Molecular Structure |
|
| Density |
1.31g/cm3 |
| Melting point |
72℃ |
| Boiling point |
370.3°C at 760 mmHg |
| Refractive index |
1.654 |
| Flash point |
177.8°C |
| Vapour Pressur |
1.12E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
