ChemNet > CAS > 1076-59-1 3-Phenyl-5-isoxazolone
1076-59-1 3-Phenyl-5-isoxazolone
| product Name |
3-Phenyl-5-isoxazolone |
| CAS No |
1076-59-1 |
| Synonyms |
4,5-dihydro-3-phenylisoxazol-5-one; 3-phenyl-1,2-oxazol-5(4H)-one; 3-phenyl-1,2-oxazol-5(2H)-one |
| Molecular Formula |
C9H7NO2 |
| Molecular Weight |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c11-9-6-8(10-12-9)7-4-2-1-3-5-7/h1-6,10H |
| EINECS |
214-064-4 |
| Molecular Structure |
|
| Density |
1.261g/cm3 |
| Melting point |
150-154℃ |
| Boiling point |
273.8°C at 760 mmHg |
| Refractive index |
1.587 |
| Flash point |
119.4°C |
| Vapour Pressur |
0.00561mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
