ChemNet > CAS > 107834-03-7 4-(2-thienyl)benzaldehyde
107834-03-7 4-(2-thienyl)benzaldehyde
| product Name |
4-(2-thienyl)benzaldehyde |
| CAS No |
107834-03-7 |
| Synonyms |
4-(thiophen-2-yl)benzaldehyde |
| Molecular Formula |
C11H8OS |
| Molecular Weight |
188.2456 |
| InChI |
InChI=1/C11H8OS/c12-8-9-3-5-10(6-4-9)11-2-1-7-13-11/h1-8H |
| Molecular Structure |
|
| Density |
1.207g/cm3 |
| Boiling point |
324.9°C at 760 mmHg |
| Refractive index |
1.637 |
| Flash point |
122.1°C |
| Vapour Pressur |
0.000239mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
