ChemNet > CAS > 1079-02-3 Benzoic-d5 acid
1079-02-3 Benzoic-d5 acid
| product Name |
Benzoic-d5 acid |
| CAS No |
1079-02-3 |
| Molecular Formula |
C7HD5O2 |
| Molecular Weight |
127.1521 |
| InChI |
InChI=1/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/i1D,2D,3D,4D,5D |
| EINECS |
214-089-0 |
| Molecular Structure |
|
| Density |
1.247g/cm3 |
| Melting point |
120-122℃ |
| Boiling point |
249.3°C at 760 mmHg |
| Refractive index |
1.564 |
| Flash point |
111.4°C |
| Vapour Pressur |
0.0122mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
