108-49-6 2,6-Dimethylpiperazine
| product Name |
2,6-Dimethylpiperazine |
| CAS No |
108-49-6;21655-48-1 |
| Synonyms |
cis-2,6-Dimethylpiperazine; (2R,6S)-2,6-dimethylpiperazine; (2S,6S)-2,6-dimethylpiperazine; (2R,6S)-rel-2,6-DiMethylpiperazine |
| Molecular Formula |
C6H14N2 |
| Molecular Weight |
114.1888 |
| InChI |
InChI=1/C6H14N2/c1-5-3-7-4-6(2)8-5/h5-8H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| EINECS |
203-588-9 |
| Molecular Structure |
|
| Density |
0.824g/cm3 |
| Melting point |
108-111℃ |
| Boiling point |
161.1°C at 760 mmHg |
| Refractive index |
1.413 |
| Flash point |
45°C |
| Vapour Pressur |
2.31mmHg at 25°C |
| Hazard Symbols |
F:Flammable;
Xi:Irritant;
|
| Risk Codes |
R11:;
R36/37/38:;
|
| Safety Description |
S26:;
S36:;
|
|
Featured China Suppliers
| Contact |
Ms linli |
| Telephone |
+86-13958038112 |
| Email |
13958038112@139.com |
| Address |
RM6421 of North Building of Zhijiang Hotel, 188-200 Moganshan Road, Hangzhou, 310005, China |
| Contact |
Mr. Steven Qi |
| Telephone |
+86-21-54776327 |
| Email |
steven.qi@kingsunchem.com |
| Address |
Suite202, 1, No. 358 An Shun Road,Shanghai 200051, China |
| Contact |
Mr.Tao(VP) |
| Telephone |
0575-82731766 |
| Email |
tj@xingxinchem.com |
| Address |
Hangzhou Bay Fine Chemical Park, Shangyu City, Zhejiang Province, China |
| Contact |
Mr. Kang |
| Telephone |
+86-371-64899527 013837178289 |
| Email |
export@ktpharm.com |
| Address |
No. 338, Kangtai Road, Sishui Town, Xingyang City, Henan Province, China |
| Contact |
Mr.Chen |
| Telephone |
+86-571-85095566;18969113688 |
| Email |
sales@nwchemical.com |
| Address |
Room 803, Qinglian Bldg, No 139 Qingchun Road, Hangzhou, Zhejiang China |