ChemNet > CAS > 108078-14-4 2-Iodo-3-methylbenzoic acid
108078-14-4 2-Iodo-3-methylbenzoic acid
| product Name |
2-Iodo-3-methylbenzoic acid |
| CAS No |
108078-14-4 |
| Synonyms |
2-Iodo-m-toluic acid |
| Molecular Formula |
C8H7IO2 |
| Molecular Weight |
262.0444 |
| InChI |
InChI=1/C8H7IO2/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4H,1H3,(H,10,11) |
| Molecular Structure |
|
| Density |
1.867g/cm3 |
| Boiling point |
323.5°C at 760 mmHg |
| Refractive index |
1.645 |
| Flash point |
149.5°C |
| Vapour Pressur |
0.000107mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
