ChemNet > CAS > 1081-75-0 1,3-Diphenylpropane
1081-75-0 1,3-Diphenylpropane
| product Name |
1,3-Diphenylpropane |
| CAS No |
1081-75-0 |
| Synonyms |
NSC 54371; Benzene, 1,1'-(1,3-propanediyl)bis- (9CI); Propane, 1,3-diphenyl- (8CI); 1,1'-propane-1,3-diyldibenzene |
| Molecular Formula |
C15H16 |
| Molecular Weight |
196.2875 |
| InChI |
InChI=1/C15H16/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2 |
| EINECS |
214-101-4 |
| Molecular Structure |
|
| Density |
0.984g/cm3 |
| Boiling point |
300.3°C at 760 mmHg |
| Refractive index |
1.564 |
| Flash point |
129.2°C |
| Vapour Pressur |
0.00202mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
