1081-75-0 1,3-Diphenylpropane
product Name |
1,3-Diphenylpropane |
CAS No |
1081-75-0 |
Synonyms |
NSC 54371; Benzene, 1,1'-(1,3-propanediyl)bis- (9CI); Propane, 1,3-diphenyl- (8CI); 1,1'-propane-1,3-diyldibenzene |
Molecular Formula |
C15H16 |
Molecular Weight |
196.2875 |
InChI |
InChI=1/C15H16/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2 |
EINECS |
214-101-4 |
Molecular Structure |
|
Density |
0.984g/cm3 |
Boiling point |
300.3°C at 760 mmHg |
Refractive index |
1.564 |
Flash point |
129.2°C |
Vapour Pressur |
0.00202mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|