ChemNet > CAS > 1083-30-3 beta-Phenylpropiophenone
1083-30-3 beta-Phenylpropiophenone
| product Name |
beta-Phenylpropiophenone |
| CAS No |
1083-30-3 |
| Synonyms |
1,3-Diphenyl-1-propanone; 1,3-diphenylpropan-1-one |
| Molecular Formula |
C15H14O |
| Molecular Weight |
210.2711 |
| InChI |
InChI=1/C15H14O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10H,11-12H2 |
| Molecular Structure |
|
| Density |
1.061g/cm3 |
| Boiling point |
352.7°C at 760 mmHg |
| Refractive index |
1.574 |
| Flash point |
152.9°C |
| Vapour Pressur |
3.78E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
