ChemNet > CAS > 108847-20-7 Dibenzothiophene-4-boronic acid
108847-20-7 Dibenzothiophene-4-boronic acid
| product Name |
Dibenzothiophene-4-boronic acid |
| CAS No |
108847-20-7 |
| Synonyms |
Dibenzo[b,d]thiophen-4-ylboronic acid; 4-Dibenzothienylboronic acid; 4-DIBENZOTHIOPHENEBORONIC ACID |
| Molecular Formula |
C12H9BO2S |
| Molecular Weight |
228.0747 |
| InChI |
InChI=1/C12H9BO2S/c14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10/h1-7,14-15H |
| Molecular Structure |
|
| Density |
1.38g/cm3 |
| Melting point |
327-330℃ |
| Boiling point |
480.2°C at 760 mmHg |
| Refractive index |
1.738 |
| Flash point |
244.2°C |
| Vapour Pressur |
4.97E-10mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S22:;
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|
