ChemNet > CAS > 108847-76-3 Thianthrene-1-boronic acid
108847-76-3 Thianthrene-1-boronic acid
| product Name |
Thianthrene-1-boronic acid |
| CAS No |
108847-76-3 |
| Synonyms |
1-Thianthrenylboronic acid; thianthren-1-ylboronic acid |
| Molecular Formula |
C12H9BO2S2 |
| Molecular Weight |
260.1397 |
| InChI |
InChI=1/C12H9BO2S2/c14-13(15)8-4-3-7-11-12(8)17-10-6-2-1-5-9(10)16-11/h1-7,14-15H |
| Molecular Structure |
|
| Density |
1.48g/cm3 |
| Melting point |
146-149℃ |
| Boiling point |
472.7°C at 760 mmHg |
| Refractive index |
1.756 |
| Flash point |
239.7°C |
| Vapour Pressur |
9.64E-10mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
